C10H14N5O4P — CID 54118181
[5-(6-aminopurin-9-yl)-3-hydroxypent-1-enyl]phosphonic acid (PubChem CID 54118181) has the molecular formula C10H14N5O4P and a molecular weight of 299.23 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-3-hydroxypent-1-enyl]phosphonic acid.
| Compound Name | [5-(6-aminopurin-9-yl)-3-hydroxypent-1-enyl]phosphonic acid |
|---|---|
| PubChem CID | 54118181 |
| Molecular Formula | C10H14N5O4P |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-3-hydroxypent-1-enyl]phosphonic acid |
| SMILES | Nc1ncnc2c1ncn2CCC(O)C=CP(=O)(O)O |
| InChI | InChI=1S/C10H14N5O4P/c11-9-8-10(13-5-12-9)15(6-14-8)3-1-7(16)2-4-20(17,18)19/h2,4-7,16H,1,3H2,(H2,11,12,13)(H2,17,18,19) |
| InChIKey | NLUMHPSLOZDFSR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|