C10H14N6O2 — CID 15518562
(2S)-2-amino-5-(6-aminopurin-9-yl)pentanoic acid (PubChem CID 15518562) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is (2S)-2-amino-5-(6-aminopurin-9-yl)pentanoic acid.
| Compound Name | (2S)-2-amino-5-(6-aminopurin-9-yl)pentanoic acid |
|---|---|
| PubChem CID | 15518562 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (2S)-2-amino-5-(6-aminopurin-9-yl)pentanoic acid |
| SMILES | Nc1ncnc2c1ncn2CCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H14N6O2/c11-6(10(17)18)2-1-3-16-5-15-7-8(12)13-4-14-9(7)16/h4-6H,1-3,11H2,(H,17,18)(H2,12,13,14)/t6-/m0/s1 |
| InChIKey | SEGLQDHIEXCIKN-LURJTMIESA-N |
| XLogP | -0.40 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |