C11H13N5O4 — CID 163729575
2-acetyloxy-4-(6-aminopurin-9-yl)butanoic acid (PubChem CID 163729575) has the molecular formula C11H13N5O4 and a molecular weight of 279.26 g/mol. Its IUPAC name is 2-acetyloxy-4-(6-aminopurin-9-yl)butanoic acid.
| Compound Name | 2-acetyloxy-4-(6-aminopurin-9-yl)butanoic acid |
|---|---|
| PubChem CID | 163729575 |
| Molecular Formula | C11H13N5O4 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-acetyloxy-4-(6-aminopurin-9-yl)butanoic acid |
| SMILES | CC(=O)OC(CCn1cnc2c(N)ncnc21)C(=O)O |
| InChI | InChI=1S/C11H13N5O4/c1-6(17)20-7(11(18)19)2-3-16-5-15-8-9(12)13-4-14-10(8)16/h4-5,7H,2-3H2,1H3,(H,18,19)(H2,12,13,14) |
| InChIKey | KYLOLBHAXAFIQI-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |