C11H16N6O3S — CID 102020867
(2R)-2-amino-3-[2-[(6-aminopurin-9-yl)methoxy]ethylsulfanyl]propanoic acid (PubChem CID 102020867) has the molecular formula C11H16N6O3S and a molecular weight of 312.36 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-[(6-aminopurin-9-yl)methoxy]ethylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[2-[(6-aminopurin-9-yl)methoxy]ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 102020867 |
| Molecular Formula | C11H16N6O3S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (2R)-2-amino-3-[2-[(6-aminopurin-9-yl)methoxy]ethylsulfanyl]propanoic acid |
| SMILES | Nc1ncnc2c1ncn2COCCSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C11H16N6O3S/c12-7(11(18)19)3-21-2-1-20-6-17-5-16-8-9(13)14-4-15-10(8)17/h4-5,7H,1-3,6,12H2,(H,18,19)(H2,13,14,15)/t7-/m0/s1 |
| InChIKey | CSNONLJCTFYVRS-ZETCQYMHSA-N |
| XLogP | -0.47 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|