C8H12N6O4S — CID 10424192
2-[(6-aminopurin-9-yl)methoxy]ethyl sulfamate (PubChem CID 10424192) has the molecular formula C8H12N6O4S and a molecular weight of 288.29 g/mol. Its IUPAC name is 2-[(6-aminopurin-9-yl)methoxy]ethyl sulfamate.
| Compound Name | 2-[(6-aminopurin-9-yl)methoxy]ethyl sulfamate |
|---|---|
| PubChem CID | 10424192 |
| Molecular Formula | C8H12N6O4S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-[(6-aminopurin-9-yl)methoxy]ethyl sulfamate |
| SMILES | Nc1ncnc2c1ncn2COCCOS(N)(=O)=O |
| InChI | InChI=1S/C8H12N6O4S/c9-7-6-8(12-3-11-7)14(4-13-6)5-17-1-2-18-19(10,15)16/h3-4H,1-2,5H2,(H2,9,11,12)(H2,10,15,16) |
| InChIKey | BGUQVFPTNOCVHL-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 148.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|