C10H12F3N5O — CID 55215661
9-[3-(2,2,2-trifluoroethoxy)propyl]purin-6-amine (PubChem CID 55215661) has the molecular formula C10H12F3N5O and a molecular weight of 275.23 g/mol. Its IUPAC name is 9-[3-(2,2,2-trifluoroethoxy)propyl]purin-6-amine.
| Compound Name | 9-[3-(2,2,2-trifluoroethoxy)propyl]purin-6-amine |
|---|---|
| PubChem CID | 55215661 |
| Molecular Formula | C10H12F3N5O |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 9-[3-(2,2,2-trifluoroethoxy)propyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CCCOCC(F)(F)F |
| InChI | InChI=1S/C10H12F3N5O/c11-10(12,13)4-19-3-1-2-18-6-17-7-8(14)15-5-16-9(7)18/h5-6H,1-4H2,(H2,14,15,16) |
| InChIKey | DFSJJUDHHKGRII-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|