C11H14F3N5O — CID 66425509
9-[3-(1,1,1-trifluoropropan-2-yloxy)propyl]purin-6-amine (PubChem CID 66425509) has the molecular formula C11H14F3N5O and a molecular weight of 289.26 g/mol. Its IUPAC name is 9-[3-(1,1,1-trifluoropropan-2-yloxy)propyl]purin-6-amine.
| Compound Name | 9-[3-(1,1,1-trifluoropropan-2-yloxy)propyl]purin-6-amine |
|---|---|
| PubChem CID | 66425509 |
| Molecular Formula | C11H14F3N5O |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 9-[3-(1,1,1-trifluoropropan-2-yloxy)propyl]purin-6-amine |
| SMILES | CC(OCCCn1cnc2c(N)ncnc21)C(F)(F)F |
| InChI | InChI=1S/C11H14F3N5O/c1-7(11(12,13)14)20-4-2-3-19-6-18-8-9(15)16-5-17-10(8)19/h5-7H,2-4H2,1H3,(H2,15,16,17) |
| InChIKey | ZQBGIOZZTYDLFF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|