C20H28N10S2 — CID 102169719
9-[5-[5-(6-aminopurin-9-yl)pentyldisulfanyl]pentyl]purin-6-amine (PubChem CID 102169719) has the molecular formula C20H28N10S2 and a molecular weight of 472.65 g/mol. Its IUPAC name is 9-[5-[5-(6-aminopurin-9-yl)pentyldisulfanyl]pentyl]purin-6-amine.
| Compound Name | 9-[5-[5-(6-aminopurin-9-yl)pentyldisulfanyl]pentyl]purin-6-amine |
|---|---|
| PubChem CID | 102169719 |
| Molecular Formula | C20H28N10S2 |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 9-[5-[5-(6-aminopurin-9-yl)pentyldisulfanyl]pentyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CCCCCSSCCCCCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C20H28N10S2/c21-17-15-19(25-11-23-17)29(13-27-15)7-3-1-5-9-31-32-10-6-2-4-8-30-14-28-16-18(22)24-12-26-20(16)30/h11-14H,1-10H2,(H2,21,23,25)(H2,22,24,26) |
| InChIKey | JLMLEHCBMBLBLR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 139.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|