C11H19N5OSi — CID 10061415
[3-(6-aminopurin-9-yl)propyl-dimethylsilyl]methanol (PubChem CID 10061415) has the molecular formula C11H19N5OSi and a molecular weight of 265.39 g/mol. Its IUPAC name is [3-(6-aminopurin-9-yl)propyl-dimethylsilyl]methanol.
| Compound Name | [3-(6-aminopurin-9-yl)propyl-dimethylsilyl]methanol |
|---|---|
| PubChem CID | 10061415 |
| Molecular Formula | C11H19N5OSi |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | [3-(6-aminopurin-9-yl)propyl-dimethylsilyl]methanol |
| SMILES | C[Si](C)(CO)CCCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H19N5OSi/c1-18(2,8-17)5-3-4-16-7-15-9-10(12)13-6-14-11(9)16/h6-7,17H,3-5,8H2,1-2H3,(H2,12,13,14) |
| InChIKey | KMVMKJVVWKUSQA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|