C8H11N5O3S — CID 14056435
3-(6-aminopurin-9-yl)propane-1-sulfonic acid (PubChem CID 14056435) has the molecular formula C8H11N5O3S and a molecular weight of 257.27 g/mol. Its IUPAC name is 3-(6-aminopurin-9-yl)propane-1-sulfonic acid.
| Compound Name | 3-(6-aminopurin-9-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 14056435 |
| Molecular Formula | C8H11N5O3S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 3-(6-aminopurin-9-yl)propane-1-sulfonic acid |
| SMILES | Nc1ncnc2c1ncn2CCCS(=O)(=O)O |
| InChI | InChI=1S/C8H11N5O3S/c9-7-6-8(11-4-10-7)13(5-12-6)2-1-3-17(14,15)16/h4-5H,1-3H2,(H2,9,10,11)(H,14,15,16) |
| InChIKey | VLHMGMJBEZFPKZ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|