C12H13N7O — CID 66424327
1-[3-(6-aminopurin-9-yl)propyl]pyrimidin-2-one (PubChem CID 66424327) has the molecular formula C12H13N7O and a molecular weight of 271.28 g/mol. Its IUPAC name is 1-[3-(6-aminopurin-9-yl)propyl]pyrimidin-2-one.
| Compound Name | 1-[3-(6-aminopurin-9-yl)propyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 66424327 |
| Molecular Formula | C12H13N7O |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-[3-(6-aminopurin-9-yl)propyl]pyrimidin-2-one |
| SMILES | Nc1ncnc2c1ncn2CCCn1cccnc1=O |
| InChI | InChI=1S/C12H13N7O/c13-10-9-11(16-7-15-10)19(8-17-9)6-2-5-18-4-1-3-14-12(18)20/h1,3-4,7-8H,2,5-6H2,(H2,13,15,16) |
| InChIKey | LIFZMXVXXXQNRT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |