C13H13N7 — CID 114650911
1-[3-(6-aminopurin-9-yl)propyl]pyrrole-2-carbonitrile (PubChem CID 114650911) has the molecular formula C13H13N7 and a molecular weight of 267.30 g/mol. Its IUPAC name is 1-[3-(6-aminopurin-9-yl)propyl]pyrrole-2-carbonitrile.
| Compound Name | 1-[3-(6-aminopurin-9-yl)propyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 114650911 |
| Molecular Formula | C13H13N7 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-[3-(6-aminopurin-9-yl)propyl]pyrrole-2-carbonitrile |
| SMILES | N#Cc1cccn1CCCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H13N7/c14-7-10-3-1-4-19(10)5-2-6-20-9-18-11-12(15)16-8-17-13(11)20/h1,3-4,8-9H,2,5-6H2,(H2,15,16,17) |
| InChIKey | FYIZVKNJOQUUAR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |