C42H38N10O2 — CID 102026182
9-[3-[4-[1-[4-[3-(6-aminopurin-9-yl)propoxy]phenyl]-2,2-diphenylethenyl]phenoxy]propyl]purin-6-amine (PubChem CID 102026182) has the molecular formula C42H38N10O2 and a molecular weight of 714.83 g/mol. Its IUPAC name is 9-[3-[4-[1-[4-[3-(6-aminopurin-9-yl)propoxy]phenyl]-2,2-diphenylethenyl]phenoxy]propyl]purin-6-amine.
| Compound Name | 9-[3-[4-[1-[4-[3-(6-aminopurin-9-yl)propoxy]phenyl]-2,2-diphenylethenyl]phenoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 102026182 |
| Molecular Formula | C42H38N10O2 |
| Molecular Weight | 714.83 g/mol |
| Exact Mass | 714.32 |
| IUPAC Name | 9-[3-[4-[1-[4-[3-(6-aminopurin-9-yl)propoxy]phenyl]-2,2-diphenylethenyl]phenoxy]propyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CCCOc1ccc(C(=C(c2ccccc2)c2ccccc2)c2ccc(OCCCn3cnc4c(N)ncnc43)cc2)cc1 |
| InChI | InChI=1S/C42H38N10O2/c43-39-37-41(47-25-45-39)51(27-49-37)21-7-23-53-33-17-13-31(14-18-33)36(35(29-9-3-1-4-10-29)30-11-5-2-6-12-30)32-15-19-34(20-16-32)54-24-8-22-52-28-50-38-40(44)46-26-48-42(38)52/h1-6,9-20,25-28H,7-8,21-24H2,(H2,43,45,47)(H2,44,46,48) |
| InChIKey | LZUFFRQGFZJFBG-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 157.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.83 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|