C39H36N6O4 — CID 102383764
[4-[4-[4-(6-aminopurin-9-yl)butoxy]phenyl]phenyl] 5-[4-(4-cyanophenyl)phenoxy]pentanoate (PubChem CID 102383764) has the molecular formula C39H36N6O4 and a molecular weight of 652.76 g/mol. Its IUPAC name is [4-[4-[4-(6-aminopurin-9-yl)butoxy]phenyl]phenyl] 5-[4-(4-cyanophenyl)phenoxy]pentanoate.
| Compound Name | [4-[4-[4-(6-aminopurin-9-yl)butoxy]phenyl]phenyl] 5-[4-(4-cyanophenyl)phenoxy]pentanoate |
|---|---|
| PubChem CID | 102383764 |
| Molecular Formula | C39H36N6O4 |
| Molecular Weight | 652.76 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | [4-[4-[4-(6-aminopurin-9-yl)butoxy]phenyl]phenyl] 5-[4-(4-cyanophenyl)phenoxy]pentanoate |
| SMILES | N#Cc1ccc(-c2ccc(OCCCCC(=O)Oc3ccc(-c4ccc(OCCCCn5cnc6c(N)ncnc65)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H36N6O4/c40-25-28-6-8-29(9-7-28)30-10-16-33(17-11-30)47-23-3-1-5-36(46)49-35-20-14-32(15-21-35)31-12-18-34(19-13-31)48-24-4-2-22-45-27-44-37-38(41)42-26-43-39(37)45/h6-21,26-27H,1-5,22-24H2,(H2,41,42,43) |
| InChIKey | LRCNBPDWTNEZBE-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.76 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|