C33H60N6O2 — CID 142349884
octyl 8-[3-(6-aminopurin-9-yl)propyl-nonylamino]octanoate (PubChem CID 142349884) has the molecular formula C33H60N6O2 and a molecular weight of 572.88 g/mol. Its IUPAC name is octyl 8-[3-(6-aminopurin-9-yl)propyl-nonylamino]octanoate.
| Compound Name | octyl 8-[3-(6-aminopurin-9-yl)propyl-nonylamino]octanoate |
|---|---|
| PubChem CID | 142349884 |
| Molecular Formula | C33H60N6O2 |
| Molecular Weight | 572.88 g/mol |
| Exact Mass | 572.48 |
| IUPAC Name | octyl 8-[3-(6-aminopurin-9-yl)propyl-nonylamino]octanoate |
| SMILES | CCCCCCCCCN(CCCCCCCC(=O)OCCCCCCCC)CCCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C33H60N6O2/c1-3-5-7-9-11-14-18-23-38(25-21-26-39-29-37-31-32(34)35-28-36-33(31)39)24-19-15-12-13-17-22-30(40)41-27-20-16-10-8-6-4-2/h28-29H,3-27H2,1-2H3,(H2,34,35,36) |
| InChIKey | OFIYHEAOQKOHJY-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.88 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|