C49H88N6O4 — CID 142431592
octyl 8-[3-(6-aminopurin-9-yl)propyl-[8-[(E)-heptadec-5-en-9-yl]oxy-8-oxooctyl]amino]octanoate (PubChem CID 142431592) has the molecular formula C49H88N6O4 and a molecular weight of 825.28 g/mol. Its IUPAC name is octyl 8-[3-(6-aminopurin-9-yl)propyl-[8-[(E)-heptadec-5-en-9-yl]oxy-8-oxooctyl]amino]octanoate.
| Compound Name | octyl 8-[3-(6-aminopurin-9-yl)propyl-[8-[(E)-heptadec-5-en-9-yl]oxy-8-oxooctyl]amino]octanoate |
|---|---|
| PubChem CID | 142431592 |
| Molecular Formula | C49H88N6O4 |
| Molecular Weight | 825.28 g/mol |
| Exact Mass | 824.69 |
| IUPAC Name | octyl 8-[3-(6-aminopurin-9-yl)propyl-[8-[(E)-heptadec-5-en-9-yl]oxy-8-oxooctyl]amino]octanoate |
| SMILES | CCCC/C=C/CCC(CCCCCCCC)OC(=O)CCCCCCCN(CCCCCCCC(=O)OCCCCCCCC)CCCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C49H88N6O4/c1-4-7-10-13-18-25-33-44(34-26-19-14-11-8-5-2)59-46(57)36-28-21-17-23-30-38-54(39-32-40-55-43-53-47-48(50)51-42-52-49(47)55)37-29-22-16-20-27-35-45(56)58-41-31-24-15-12-9-6-3/h13,18,42-44H,4-12,14-17,19-41H2,1-3H3,(H2,50,51,52)/b18-13+ |
| InChIKey | JPGVCQREYLUUHS-QGOAFFKASA-N |
| XLogP | 12.87 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.28 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|