C36H67NO5 — CID 155278348
[(2Z,9Z)-dodeca-2,9-dien-6-yl] 8-[2-hydroxyethyl-(6-octoxy-6-oxohexyl)amino]octanoate (PubChem CID 155278348) has the molecular formula C36H67NO5 and a molecular weight of 593.93 g/mol. Its IUPAC name is [(2Z,9Z)-dodeca-2,9-dien-6-yl] 8-[2-hydroxyethyl-(6-octoxy-6-oxohexyl)amino]octanoate.
| Compound Name | [(2Z,9Z)-dodeca-2,9-dien-6-yl] 8-[2-hydroxyethyl-(6-octoxy-6-oxohexyl)amino]octanoate |
|---|---|
| PubChem CID | 155278348 |
| Molecular Formula | C36H67NO5 |
| Molecular Weight | 593.93 g/mol |
| Exact Mass | 593.50 |
| IUPAC Name | [(2Z,9Z)-dodeca-2,9-dien-6-yl] 8-[2-hydroxyethyl-(6-octoxy-6-oxohexyl)amino]octanoate |
| SMILES | C/C=C\CCC(CC/C=C\CC)OC(=O)CCCCCCCN(CCO)CCCCCC(=O)OCCCCCCCC |
| InChI | InChI=1S/C36H67NO5/c1-4-7-10-12-16-24-33-41-35(39)27-21-17-23-30-37(31-32-38)29-22-15-13-14-20-28-36(40)42-34(25-18-9-6-3)26-19-11-8-5-2/h6,8-9,11,34,38H,4-5,7,10,12-33H2,1-3H3/b9-6-,11-8- |
| InChIKey | CIAFCURVYPIJTP-WALAJLDXSA-N |
| XLogP | 9.10 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.93 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|