C49H92N6O5 — CID 146563973
octyl 8-[3-(2-amino-6-hydroxy-3,6-dihydropurin-9-yl)propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 146563973) has the molecular formula C49H92N6O5 and a molecular weight of 845.31 g/mol. Its IUPAC name is octyl 8-[3-(2-amino-6-hydroxy-3,6-dihydropurin-9-yl)propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | octyl 8-[3-(2-amino-6-hydroxy-3,6-dihydropurin-9-yl)propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 146563973 |
| Molecular Formula | C49H92N6O5 |
| Molecular Weight | 845.31 g/mol |
| Exact Mass | 844.71 |
| IUPAC Name | octyl 8-[3-(2-amino-6-hydroxy-3,6-dihydropurin-9-yl)propyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCn1cnc2c1NC(N)=NC2O |
| InChI | InChI=1S/C49H92N6O5/c1-4-7-10-13-18-25-33-43(34-26-19-14-11-8-5-2)60-45(57)36-28-21-17-23-30-38-54(39-32-40-55-42-51-46-47(55)52-49(50)53-48(46)58)37-29-22-16-20-27-35-44(56)59-41-31-24-15-12-9-6-3/h42-43,48,58H,4-41H2,1-3H3,(H3,50,52,53) |
| InChIKey | OYCTUXGBOCOUMJ-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 144.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.31 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|