C17H23N5O4 — CID 171061856
6-prop-2-enoyloxyhexyl 3-(6-aminopurin-9-yl)propanoate (PubChem CID 171061856) has the molecular formula C17H23N5O4 and a molecular weight of 361.40 g/mol. Its IUPAC name is 6-prop-2-enoyloxyhexyl 3-(6-aminopurin-9-yl)propanoate.
| Compound Name | 6-prop-2-enoyloxyhexyl 3-(6-aminopurin-9-yl)propanoate |
|---|---|
| PubChem CID | 171061856 |
| Molecular Formula | C17H23N5O4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 6-prop-2-enoyloxyhexyl 3-(6-aminopurin-9-yl)propanoate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)CCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C17H23N5O4/c1-2-13(23)25-9-5-3-4-6-10-26-14(24)7-8-22-12-21-15-16(18)19-11-20-17(15)22/h2,11-12H,1,3-10H2,(H2,18,19,20) |
| InChIKey | UWQUZMUYVRUWSN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|