C12H14N6O3 — CID 66424528
4-[3-(6-aminopurin-9-yl)propyl]morpholine-3,5-dione (PubChem CID 66424528) has the molecular formula C12H14N6O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 4-[3-(6-aminopurin-9-yl)propyl]morpholine-3,5-dione.
| Compound Name | 4-[3-(6-aminopurin-9-yl)propyl]morpholine-3,5-dione |
|---|---|
| PubChem CID | 66424528 |
| Molecular Formula | C12H14N6O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-[3-(6-aminopurin-9-yl)propyl]morpholine-3,5-dione |
| SMILES | Nc1ncnc2c1ncn2CCCN1C(=O)COCC1=O |
| InChI | InChI=1S/C12H14N6O3/c13-11-10-12(15-6-14-11)17(7-16-10)2-1-3-18-8(19)4-21-5-9(18)20/h6-7H,1-5H2,(H2,13,14,15) |
| InChIKey | QLTDRZNRJLHBGO-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|