C14H22N6O — CID 62897812
9-[3-(3,3-dimethylmorpholin-4-yl)propyl]purin-6-amine (PubChem CID 62897812) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is 9-[3-(3,3-dimethylmorpholin-4-yl)propyl]purin-6-amine.
| Compound Name | 9-[3-(3,3-dimethylmorpholin-4-yl)propyl]purin-6-amine |
|---|---|
| PubChem CID | 62897812 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 9-[3-(3,3-dimethylmorpholin-4-yl)propyl]purin-6-amine |
| SMILES | CC1(C)COCCN1CCCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H22N6O/c1-14(2)8-21-7-6-20(14)5-3-4-19-10-18-11-12(15)16-9-17-13(11)19/h9-10H,3-8H2,1-2H3,(H2,15,16,17) |
| InChIKey | CNGMMGIKUOVMRH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |