C16H16N6O3 — CID 101208829
(3aR,4S,7R,7aS)-2-[3-(6-aminopurin-9-yl)propyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 101208829) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is (3aR,4S,7R,7aS)-2-[3-(6-aminopurin-9-yl)propyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7R,7aS)-2-[3-(6-aminopurin-9-yl)propyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 101208829 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (3aR,4S,7R,7aS)-2-[3-(6-aminopurin-9-yl)propyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | Nc1ncnc2c1ncn2CCCN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C16H16N6O3/c17-13-12-14(19-6-18-13)21(7-20-12)4-1-5-22-15(23)10-8-2-3-9(25-8)11(10)16(22)24/h2-3,6-11H,1,4-5H2,(H2,17,18,19)/t8-,9+,10-,11+ |
| InChIKey | YIHSLCYBFWYQGV-DTIDVZRVSA-N |
| XLogP | -0.26 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|