C12H14F6N5O4P — CID 19349735
[3-[2-(6-aminopurin-9-yl)ethoxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid (PubChem CID 19349735) has the molecular formula C12H14F6N5O4P and a molecular weight of 437.24 g/mol. Its IUPAC name is [3-[2-(6-aminopurin-9-yl)ethoxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid.
| Compound Name | [3-[2-(6-aminopurin-9-yl)ethoxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 19349735 |
| Molecular Formula | C12H14F6N5O4P |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | [3-[2-(6-aminopurin-9-yl)ethoxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid |
| SMILES | Nc1ncnc2c1ncn2CCOC(CC(F)(F)F)(CC(F)(F)F)P(=O)(O)O |
| InChI | InChI=1S/C12H14F6N5O4P/c13-11(14,15)3-10(28(24,25)26,4-12(16,17)18)27-2-1-23-6-22-7-8(19)20-5-21-9(7)23/h5-6H,1-4H2,(H2,19,20,21)(H2,24,25,26) |
| InChIKey | AMVSARHRVORVHR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|