C14H19F6N6O4P — CID 21253163
[3-[2-[2-amino-6-(dimethylamino)purin-9-yl]ethoxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid (PubChem CID 21253163) has the molecular formula C14H19F6N6O4P and a molecular weight of 480.31 g/mol. Its IUPAC name is [3-[2-[2-amino-6-(dimethylamino)purin-9-yl]ethoxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid.
| Compound Name | [3-[2-[2-amino-6-(dimethylamino)purin-9-yl]ethoxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 21253163 |
| Molecular Formula | C14H19F6N6O4P |
| Molecular Weight | 480.31 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | [3-[2-[2-amino-6-(dimethylamino)purin-9-yl]ethoxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid |
| SMILES | CN(C)c1nc(N)nc2c1ncn2CCOC(CC(F)(F)F)(CC(F)(F)F)P(=O)(O)O |
| InChI | InChI=1S/C14H19F6N6O4P/c1-25(2)9-8-10(24-11(21)23-9)26(7-22-8)3-4-30-12(31(27,28)29,5-13(15,16)17)6-14(18,19)20/h7H,3-6H2,1-2H3,(H2,21,23,24)(H2,27,28,29) |
| InChIKey | YNMWUPQTYABNIP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|