C20H23F6N6O4P — CID 21253164
[3-[1-[2-amino-6-(2-methylanilino)purin-9-yl]propan-2-yloxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid (PubChem CID 21253164) has the molecular formula C20H23F6N6O4P and a molecular weight of 556.40 g/mol. Its IUPAC name is [3-[1-[2-amino-6-(2-methylanilino)purin-9-yl]propan-2-yloxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid.
| Compound Name | [3-[1-[2-amino-6-(2-methylanilino)purin-9-yl]propan-2-yloxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 21253164 |
| Molecular Formula | C20H23F6N6O4P |
| Molecular Weight | 556.40 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | [3-[1-[2-amino-6-(2-methylanilino)purin-9-yl]propan-2-yloxy]-1,1,1,5,5,5-hexafluoropentan-3-yl]phosphonic acid |
| SMILES | Cc1ccccc1Nc1nc(N)nc2c1ncn2CC(C)OC(CC(F)(F)F)(CC(F)(F)F)P(=O)(O)O |
| InChI | InChI=1S/C20H23F6N6O4P/c1-11-5-3-4-6-13(11)29-15-14-16(31-17(27)30-15)32(10-28-14)7-12(2)36-18(37(33,34)35,8-19(21,22)23)9-20(24,25)26/h3-6,10,12H,7-9H2,1-2H3,(H2,33,34,35)(H3,27,29,30,31) |
| InChIKey | VOMITNFWBBUEJB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|