C13H22N7Na2O5P — CID 11441870
disodium;1-[2-amino-6-[2-(dimethylamino)ethylamino]purin-9-yl]-3-(phosphonatomethoxy)propan-2-ol (PubChem CID 11441870) has the molecular formula C13H22N7Na2O5P and a molecular weight of 433.32 g/mol. Its IUPAC name is disodium;1-[2-amino-6-[2-(dimethylamino)ethylamino]purin-9-yl]-3-(phosphonatomethoxy)propan-2-ol.
| Compound Name | disodium;1-[2-amino-6-[2-(dimethylamino)ethylamino]purin-9-yl]-3-(phosphonatomethoxy)propan-2-ol |
|---|---|
| PubChem CID | 11441870 |
| Molecular Formula | C13H22N7Na2O5P |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | disodium;1-[2-amino-6-[2-(dimethylamino)ethylamino]purin-9-yl]-3-(phosphonatomethoxy)propan-2-ol |
| SMILES | CN(C)CCNc1nc(N)nc2c1ncn2CC(O)COCP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C13H24N7O5P.2Na/c1-19(2)4-3-15-11-10-12(18-13(14)17-11)20(7-16-10)5-9(21)6-25-8-26(22,23)24;;/h7,9,21H,3-6,8H2,1-2H3,(H2,22,23,24)(H3,14,15,17,18);;/q;2*+1/p-2 |
| InChIKey | YHYLMINVPSWLDU-UHFFFAOYSA-L |
| XLogP | -8.36 |
| TPSA | 177.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | -8.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|