C8H10N5O6P-2 — CID 176583496
[3-(2-amino-6-oxo-1H-purin-9-yl)-2-hydroxypropyl] phosphate (PubChem CID 176583496) has the molecular formula C8H10N5O6P-2 and a molecular weight of 303.17 g/mol. Its IUPAC name is [3-(2-amino-6-oxo-1H-purin-9-yl)-2-hydroxypropyl] phosphate.
| Compound Name | [3-(2-amino-6-oxo-1H-purin-9-yl)-2-hydroxypropyl] phosphate |
|---|---|
| PubChem CID | 176583496 |
| Molecular Formula | C8H10N5O6P-2 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | [3-(2-amino-6-oxo-1H-purin-9-yl)-2-hydroxypropyl] phosphate |
| SMILES | Nc1nc2c(ncn2CC(O)COP(=O)([O-])[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C8H12N5O6P/c9-8-11-6-5(7(15)12-8)10-3-13(6)1-4(14)2-19-20(16,17)18/h3-4,14H,1-2H2,(H2,16,17,18)(H3,9,11,12,15)/p-2 |
| InChIKey | RFPODYUIIQSFDZ-UHFFFAOYSA-L |
| XLogP | -3.09 |
| TPSA | 182.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|