C20H32N10O9P2 — CID 137083265
[(2S)-1-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxypropan-2-yl]oxymethyl-methylphosphinic acid;[(2R)-1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-yl]oxymethyl-methylphosphinic acid (PubChem CID 137083265) has the molecular formula C20H32N10O9P2 and a molecular weight of 618.49 g/mol. Its IUPAC name is [(2S)-1-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxypropan-2-yl]oxymethyl-methylphosphinic acid;[(2R)-1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-yl]oxymethyl-methylphosphinic acid.
| Compound Name | [(2S)-1-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxypropan-2-yl]oxymethyl-methylphosphinic acid;[(2R)-1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-yl]oxymethyl-methylphosphinic acid |
|---|---|
| PubChem CID | 137083265 |
| Molecular Formula | C20H32N10O9P2 |
| Molecular Weight | 618.49 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | [(2S)-1-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxypropan-2-yl]oxymethyl-methylphosphinic acid;[(2R)-1-(2-amino-6-oxo-1H-purin-9-yl)propan-2-yl]oxymethyl-methylphosphinic acid |
| SMILES | CP(=O)(O)CO[C@H](CO)Cn1cnc2c(=O)[nH]c(N)nc21.C[C@H](Cn1cnc2c(=O)[nH]c(N)nc21)OCP(C)(=O)O |
| InChI | InChI=1S/C10H16N5O5P.C10H16N5O4P/c1-21(18,19)5-20-6(3-16)2-15-4-12-7-8(15)13-10(11)14-9(7)17;1-6(19-5-20(2,17)18)3-15-4-12-7-8(15)13-10(11)14-9(7)16/h4,6,16H,2-3,5H2,1H3,(H,18,19)(H3,11,13,14,17);4,6H,3,5H2,1-2H3,(H,17,18)(H3,11,13,14,16)/t2*6-/m01/s1 |
| InChIKey | PJRYWRPHJORHHF-KPHLSGHRSA-N |
| XLogP | -1.10 |
| TPSA | 292.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.49 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|