C16H19FN5O5P — CID 137308344
[(2S)-1-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoropropan-2-yl]oxymethyl-phenylmethoxyphosphinic acid (PubChem CID 137308344) has the molecular formula C16H19FN5O5P and a molecular weight of 411.33 g/mol. Its IUPAC name is [(2S)-1-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoropropan-2-yl]oxymethyl-phenylmethoxyphosphinic acid.
| Compound Name | [(2S)-1-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoropropan-2-yl]oxymethyl-phenylmethoxyphosphinic acid |
|---|---|
| PubChem CID | 137308344 |
| Molecular Formula | C16H19FN5O5P |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [(2S)-1-(2-amino-6-oxo-1H-purin-9-yl)-3-fluoropropan-2-yl]oxymethyl-phenylmethoxyphosphinic acid |
| SMILES | Nc1nc2c(ncn2C[C@@H](CF)OCP(=O)(O)OCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H19FN5O5P/c17-6-12(7-22-9-19-13-14(22)20-16(18)21-15(13)23)26-10-28(24,25)27-8-11-4-2-1-3-5-11/h1-5,9,12H,6-8,10H2,(H,24,25)(H3,18,20,21,23)/t12-/m1/s1 |
| InChIKey | YKCIFRXDMQOQHP-GFCCVEGCSA-N |
| XLogP | 1.42 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|