C14H24N5O7P — CID 136617763
[(2S)-1-(2-amino-6-oxo-1H-purin-9-yl)-3-methoxypropan-2-yl]oxymethyl-(3-methoxypropoxy)phosphinic acid (PubChem CID 136617763) has the molecular formula C14H24N5O7P and a molecular weight of 405.35 g/mol. Its IUPAC name is [(2S)-1-(2-amino-6-oxo-1H-purin-9-yl)-3-methoxypropan-2-yl]oxymethyl-(3-methoxypropoxy)phosphinic acid.
| Compound Name | [(2S)-1-(2-amino-6-oxo-1H-purin-9-yl)-3-methoxypropan-2-yl]oxymethyl-(3-methoxypropoxy)phosphinic acid |
|---|---|
| PubChem CID | 136617763 |
| Molecular Formula | C14H24N5O7P |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [(2S)-1-(2-amino-6-oxo-1H-purin-9-yl)-3-methoxypropan-2-yl]oxymethyl-(3-methoxypropoxy)phosphinic acid |
| SMILES | COCCCOP(=O)(O)CO[C@H](COC)Cn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C14H24N5O7P/c1-23-4-3-5-26-27(21,22)9-25-10(7-24-2)6-19-8-16-11-12(19)17-14(15)18-13(11)20/h8,10H,3-7,9H2,1-2H3,(H,21,22)(H3,15,17,18,20)/t10-/m0/s1 |
| InChIKey | AKICZCYFBXDQLW-JTQLQIEISA-N |
| XLogP | -0.07 |
| TPSA | 163.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|