C9H14N5O6P — CID 167444418
[2-hydroxy-3-[2-(methylamino)-6-oxo-1H-purin-9-yl]propyl] dihydrogen phosphate (PubChem CID 167444418) has the molecular formula C9H14N5O6P and a molecular weight of 319.21 g/mol. Its IUPAC name is [2-hydroxy-3-[2-(methylamino)-6-oxo-1H-purin-9-yl]propyl] dihydrogen phosphate.
| Compound Name | [2-hydroxy-3-[2-(methylamino)-6-oxo-1H-purin-9-yl]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 167444418 |
| Molecular Formula | C9H14N5O6P |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | [2-hydroxy-3-[2-(methylamino)-6-oxo-1H-purin-9-yl]propyl] dihydrogen phosphate |
| SMILES | CNc1nc2c(ncn2CC(O)COP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H14N5O6P/c1-10-9-12-7-6(8(16)13-9)11-4-14(7)2-5(15)3-20-21(17,18)19/h4-5,15H,2-3H2,1H3,(H2,17,18,19)(H2,10,12,13,16) |
| InChIKey | SKKJCVLFNVFRDD-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 162.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|