C18H20N10O6 — CID 169440039
N-[9-[2-[(2-acetamido-6-oxo-1H-purin-9-yl)methoxy]ethoxymethyl]-6-oxo-1H-purin-2-yl]acetamide (PubChem CID 169440039) has the molecular formula C18H20N10O6 and a molecular weight of 472.42 g/mol. Its IUPAC name is N-[9-[2-[(2-acetamido-6-oxo-1H-purin-9-yl)methoxy]ethoxymethyl]-6-oxo-1H-purin-2-yl]acetamide.
| Compound Name | N-[9-[2-[(2-acetamido-6-oxo-1H-purin-9-yl)methoxy]ethoxymethyl]-6-oxo-1H-purin-2-yl]acetamide |
|---|---|
| PubChem CID | 169440039 |
| Molecular Formula | C18H20N10O6 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | N-[9-[2-[(2-acetamido-6-oxo-1H-purin-9-yl)methoxy]ethoxymethyl]-6-oxo-1H-purin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(ncn2COCCOCn2cnc3c(=O)[nH]c(NC(C)=O)nc32)c(=O)[nH]1 |
| InChI | InChI=1S/C18H20N10O6/c1-9(29)21-17-23-13-11(15(31)25-17)19-5-27(13)7-33-3-4-34-8-28-6-20-12-14(28)24-18(22-10(2)30)26-16(12)32/h5-6H,3-4,7-8H2,1-2H3,(H2,21,23,25,29,31)(H2,22,24,26,30,32) |
| InChIKey | LWEOEZYJXDPGTN-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 203.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|