C15H21N5O5 — CID 135962070
N-[9-[2-(oxan-2-yloxy)ethoxymethyl]-6-oxo-1H-purin-2-yl]acetamide (PubChem CID 135962070) has the molecular formula C15H21N5O5 and a molecular weight of 351.36 g/mol. Its IUPAC name is N-[9-[2-(oxan-2-yloxy)ethoxymethyl]-6-oxo-1H-purin-2-yl]acetamide.
| Compound Name | N-[9-[2-(oxan-2-yloxy)ethoxymethyl]-6-oxo-1H-purin-2-yl]acetamide |
|---|---|
| PubChem CID | 135962070 |
| Molecular Formula | C15H21N5O5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-[9-[2-(oxan-2-yloxy)ethoxymethyl]-6-oxo-1H-purin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(ncn2COCCOC2CCCCO2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H21N5O5/c1-10(21)17-15-18-13-12(14(22)19-15)16-8-20(13)9-23-6-7-25-11-4-2-3-5-24-11/h8,11H,2-7,9H2,1H3,(H2,17,18,19,21,22) |
| InChIKey | YFGXVJLFJWAOTO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|