C15H21N7O5 — CID 135461884
ethyl 2-[[(2S)-4-(2-acetamido-6-oxo-1H-purin-9-yl)-2-aminobutanoyl]amino]acetate (PubChem CID 135461884) has the molecular formula C15H21N7O5 and a molecular weight of 379.38 g/mol. Its IUPAC name is ethyl 2-[[(2S)-4-(2-acetamido-6-oxo-1H-purin-9-yl)-2-aminobutanoyl]amino]acetate.
| Compound Name | ethyl 2-[[(2S)-4-(2-acetamido-6-oxo-1H-purin-9-yl)-2-aminobutanoyl]amino]acetate |
|---|---|
| PubChem CID | 135461884 |
| Molecular Formula | C15H21N7O5 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | ethyl 2-[[(2S)-4-(2-acetamido-6-oxo-1H-purin-9-yl)-2-aminobutanoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)[C@@H](N)CCn1cnc2c(=O)[nH]c(NC(C)=O)nc21 |
| InChI | InChI=1S/C15H21N7O5/c1-3-27-10(24)6-17-13(25)9(16)4-5-22-7-18-11-12(22)20-15(19-8(2)23)21-14(11)26/h7,9H,3-6,16H2,1-2H3,(H,17,25)(H2,19,20,21,23,26)/t9-/m0/s1 |
| InChIKey | LEMVVYSPYRXDSU-VIFPVBQESA-N |
| XLogP | -1.53 |
| TPSA | 174.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |