C13H18N5O5P — CID 135508811
N-[9-[(Z)-2-diethoxyphosphorylethenyl]-6-oxo-1H-purin-2-yl]acetamide (PubChem CID 135508811) has the molecular formula C13H18N5O5P and a molecular weight of 355.29 g/mol. Its IUPAC name is N-[9-[(Z)-2-diethoxyphosphorylethenyl]-6-oxo-1H-purin-2-yl]acetamide.
| Compound Name | N-[9-[(Z)-2-diethoxyphosphorylethenyl]-6-oxo-1H-purin-2-yl]acetamide |
|---|---|
| PubChem CID | 135508811 |
| Molecular Formula | C13H18N5O5P |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-[9-[(Z)-2-diethoxyphosphorylethenyl]-6-oxo-1H-purin-2-yl]acetamide |
| SMILES | CCOP(=O)(/C=C\n1cnc2c(=O)[nH]c(NC(C)=O)nc21)OCC |
| InChI | InChI=1S/C13H18N5O5P/c1-4-22-24(21,23-5-2)7-6-18-8-14-10-11(18)16-13(15-9(3)19)17-12(10)20/h6-8H,4-5H2,1-3H3,(H2,15,16,17,19,20)/b7-6- |
| InChIKey | WRHYNIFKELLTHE-SREVYHEPSA-N |
| XLogP | 1.77 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|