C28H39BrN5O9PSi — CID 136648445
[(2R,3R,4R,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-2-[(E)-2-diethoxyphosphorylethenyl]-4-methoxyoxolan-3-yl] benzoate;bromo(trimethyl)silane (PubChem CID 136648445) has the molecular formula C28H39BrN5O9PSi and a molecular weight of 728.61 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-2-[(E)-2-diethoxyphosphorylethenyl]-4-methoxyoxolan-3-yl] benzoate;bromo(trimethyl)silane.
| Compound Name | [(2R,3R,4R,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-2-[(E)-2-diethoxyphosphorylethenyl]-4-methoxyoxolan-3-yl] benzoate;bromo(trimethyl)silane |
|---|---|
| PubChem CID | 136648445 |
| Molecular Formula | C28H39BrN5O9PSi |
| Molecular Weight | 728.61 g/mol |
| Exact Mass | 727.14 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-2-[(E)-2-diethoxyphosphorylethenyl]-4-methoxyoxolan-3-yl] benzoate;bromo(trimethyl)silane |
| SMILES | CCOP(=O)(/C=C/[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(NC(C)=O)nc32)[C@H](OC)[C@@H]1OC(=O)c1ccccc1)OCC.C[Si](C)(C)Br |
| InChI | InChI=1S/C25H30N5O9P.C3H9BrSi/c1-5-36-40(34,37-6-2)13-12-17-19(39-24(33)16-10-8-7-9-11-16)20(35-4)23(38-17)30-14-26-18-21(30)28-25(27-15(3)31)29-22(18)32;1-5(2,3)4/h7-14,17,19-20,23H,5-6H2,1-4H3,(H2,27,28,29,31,32);1-3H3/b13-12+;/t17-,19-,20-,23-;/m1./s1 |
| InChIKey | LDMVQGVCABRDAF-RXCVWUGWSA-N |
| XLogP | 5.21 |
| TPSA | 172.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|