C20H30N5O8P — CID 135903184
N-[9-[(2R,3R,4S,5R)-5-[(E)-2-diethoxyphosphorylethenyl]-3,4-dihydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-3-methylbutanamide (PubChem CID 135903184) has the molecular formula C20H30N5O8P and a molecular weight of 499.46 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-5-[(E)-2-diethoxyphosphorylethenyl]-3,4-dihydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-3-methylbutanamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-5-[(E)-2-diethoxyphosphorylethenyl]-3,4-dihydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 135903184 |
| Molecular Formula | C20H30N5O8P |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-5-[(E)-2-diethoxyphosphorylethenyl]-3,4-dihydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-3-methylbutanamide |
| SMILES | CCOP(=O)(/C=C/[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(NC(=O)CC(C)C)nc32)[C@H](O)[C@@H]1O)OCC |
| InChI | InChI=1S/C20H30N5O8P/c1-5-31-34(30,32-6-2)8-7-12-15(27)16(28)19(33-12)25-10-21-14-17(25)23-20(24-18(14)29)22-13(26)9-11(3)4/h7-8,10-12,15-16,19,27-28H,5-6,9H2,1-4H3,(H2,22,23,24,26,29)/b8-7+/t12-,15-,16-,19-/m1/s1 |
| InChIKey | IWUTZJGPJOXIGH-ZAFYVNJGSA-N |
| XLogP | 1.50 |
| TPSA | 177.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|