C16H22N5O11P — CID 135922976
6-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]amino]-6-oxohexanoic acid (PubChem CID 135922976) has the molecular formula C16H22N5O11P and a molecular weight of 491.35 g/mol. Its IUPAC name is 6-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]amino]-6-oxohexanoic acid.
| Compound Name | 6-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 135922976 |
| Molecular Formula | C16H22N5O11P |
| Molecular Weight | 491.35 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 6-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]amino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H22N5O11P/c22-8(3-1-2-4-9(23)24)18-16-19-13-10(14(27)20-16)17-6-21(13)15-12(26)11(25)7(32-15)5-31-33(28,29)30/h6-7,11-12,15,25-26H,1-5H2,(H,23,24)(H2,28,29,30)(H2,18,19,20,22,27)/t7-,11-,12-,15-/m1/s1 |
| InChIKey | XHVNTDYADMUOEX-UHEGPQQHSA-N |
| XLogP | -1.57 |
| TPSA | 246.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.35 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|