C11H12F3N4O8P — CID 136762852
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-oxo-2-(trifluoromethyl)-1H-purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 136762852) has the molecular formula C11H12F3N4O8P and a molecular weight of 416.21 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-oxo-2-(trifluoromethyl)-1H-purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-oxo-2-(trifluoromethyl)-1H-purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 136762852 |
| Molecular Formula | C11H12F3N4O8P |
| Molecular Weight | 416.21 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-oxo-2-(trifluoromethyl)-1H-purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=c1[nH]c(C(F)(F)F)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H12F3N4O8P/c12-11(13,14)10-16-7-4(8(21)17-10)15-2-18(7)9-6(20)5(19)3(26-9)1-25-27(22,23)24/h2-3,5-6,9,19-20H,1H2,(H,16,17,21)(H2,22,23,24)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | PDAIQSUQIOURAM-UUOKFMHZSA-N |
| XLogP | -1.13 |
| TPSA | 180.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.21 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|