C26H35FN5O6PSi — CID 87509177
N-[9-[5-[(E)-2-dimethoxyphosphorylethenyl]-3-fluoro-4-triethylsilyloxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 87509177) has the molecular formula C26H35FN5O6PSi and a molecular weight of 591.65 g/mol. Its IUPAC name is N-[9-[5-[(E)-2-dimethoxyphosphorylethenyl]-3-fluoro-4-triethylsilyloxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[5-[(E)-2-dimethoxyphosphorylethenyl]-3-fluoro-4-triethylsilyloxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 87509177 |
| Molecular Formula | C26H35FN5O6PSi |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | N-[9-[5-[(E)-2-dimethoxyphosphorylethenyl]-3-fluoro-4-triethylsilyloxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CC[Si](CC)(CC)OC1C(/C=C/P(=O)(OC)OC)OC(n2cnc3c(NC(=O)c4ccccc4)ncnc32)C1F |
| InChI | InChI=1S/C26H35FN5O6PSi/c1-6-40(7-2,8-3)38-22-19(14-15-39(34,35-4)36-5)37-26(20(22)27)32-17-30-21-23(28-16-29-24(21)32)31-25(33)18-12-10-9-11-13-18/h9-17,19-20,22,26H,6-8H2,1-5H3,(H,28,29,31,33)/b15-14+ |
| InChIKey | AEYPMJSZPWSXLH-CCEZHUSRSA-N |
| XLogP | 5.70 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|