C12H19N6O14P3 — CID 160965138
[[(2R,3R,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-3-aminooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 160965138) has the molecular formula C12H19N6O14P3 and a molecular weight of 564.23 g/mol. Its IUPAC name is [[(2R,3R,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-3-aminooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-3-aminooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 160965138 |
| Molecular Formula | C12H19N6O14P3 |
| Molecular Weight | 564.23 g/mol |
| Exact Mass | 564.02 |
| IUPAC Name | [[(2R,3R,5R)-5-(2-acetamido-6-oxo-1H-purin-9-yl)-3-aminooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(=O)Nc1nc2c(ncn2[C@H]2C[C@@H](ON)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H19N6O14P3/c1-5(19)15-12-16-10-9(11(20)17-12)14-4-18(10)8-2-6(30-13)7(29-8)3-28-34(24,25)32-35(26,27)31-33(21,22)23/h4,6-8H,2-3,13H2,1H3,(H,24,25)(H,26,27)(H2,21,22,23)(H2,15,16,17,19,20)/t6-,7-,8-/m1/s1 |
| InChIKey | LSJPYQZAXICQGL-BWZBUEFSSA-N |
| XLogP | -1.03 |
| TPSA | 296.97 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.23 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|