C14H13N5O4S — CID 136711713
N-[9-(4-methylphenyl)sulfonyl-6-oxo-1H-purin-2-yl]acetamide (PubChem CID 136711713) has the molecular formula C14H13N5O4S and a molecular weight of 347.36 g/mol. Its IUPAC name is N-[9-(4-methylphenyl)sulfonyl-6-oxo-1H-purin-2-yl]acetamide.
| Compound Name | N-[9-(4-methylphenyl)sulfonyl-6-oxo-1H-purin-2-yl]acetamide |
|---|---|
| PubChem CID | 136711713 |
| Molecular Formula | C14H13N5O4S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-[9-(4-methylphenyl)sulfonyl-6-oxo-1H-purin-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2c(ncn2S(=O)(=O)c2ccc(C)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H13N5O4S/c1-8-3-5-10(6-4-8)24(22,23)19-7-15-11-12(19)17-14(16-9(2)20)18-13(11)21/h3-7H,1-2H3,(H2,16,17,18,20,21) |
| InChIKey | IFLMQJWCSACTAE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |