C17H20N6O3S — CID 139726526
2-amino-9-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]-1H-purin-6-one (PubChem CID 139726526) has the molecular formula C17H20N6O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-amino-9-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 139726526 |
| Molecular Formula | C17H20N6O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-amino-9-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]-1H-purin-6-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H]2Cn2cnc3c(=O)[nH]c(N)nc32)cc1 |
| InChI | InChI=1S/C17H20N6O3S/c1-11-4-6-13(7-5-11)27(25,26)23-8-2-3-12(23)9-22-10-19-14-15(22)20-17(18)21-16(14)24/h4-7,10,12H,2-3,8-9H2,1H3,(H3,18,20,21,24)/t12-/m0/s1 |
| InChIKey | URSZRBUMLKGAMO-LBPRGKRZSA-N |
| XLogP | 0.86 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |