C12H17N6Na2O4P — CID 164625533
disodium;2-amino-9-[[(2S)-1-(2-phosphonatoethyl)pyrrolidin-2-yl]methyl]-1H-purin-6-one (PubChem CID 164625533) has the molecular formula C12H17N6Na2O4P and a molecular weight of 386.26 g/mol. Its IUPAC name is disodium;2-amino-9-[[(2S)-1-(2-phosphonatoethyl)pyrrolidin-2-yl]methyl]-1H-purin-6-one.
| Compound Name | disodium;2-amino-9-[[(2S)-1-(2-phosphonatoethyl)pyrrolidin-2-yl]methyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 164625533 |
| Molecular Formula | C12H17N6Na2O4P |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | disodium;2-amino-9-[[(2S)-1-(2-phosphonatoethyl)pyrrolidin-2-yl]methyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C[C@@H]2CCCN2CCP(=O)([O-])[O-])c(=O)[nH]1.[Na+].[Na+] |
| InChI | InChI=1S/C12H19N6O4P.2Na/c13-12-15-10-9(11(19)16-12)14-7-18(10)6-8-2-1-3-17(8)4-5-23(20,21)22;;/h7-8H,1-6H2,(H2,20,21,22)(H3,13,15,16,19);;/q;2*+1/p-2/t8-;;/m0../s1 |
| InChIKey | YDZNNBWOGALEMI-JZGIKJSDSA-L |
| XLogP | -7.91 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | -7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|