C17H19ClN6O2S — CID 139726529
6-chloro-9-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]purin-2-amine (PubChem CID 139726529) has the molecular formula C17H19ClN6O2S and a molecular weight of 406.90 g/mol. Its IUPAC name is 6-chloro-9-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]purin-2-amine.
| Compound Name | 6-chloro-9-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]purin-2-amine |
|---|---|
| PubChem CID | 139726529 |
| Molecular Formula | C17H19ClN6O2S |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 6-chloro-9-[[(2S)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]methyl]purin-2-amine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H]2Cn2cnc3c(Cl)nc(N)nc32)cc1 |
| InChI | InChI=1S/C17H19ClN6O2S/c1-11-4-6-13(7-5-11)27(25,26)24-8-2-3-12(24)9-23-10-20-14-15(18)21-17(19)22-16(14)23/h4-7,10,12H,2-3,8-9H2,1H3,(H2,19,21,22)/t12-/m0/s1 |
| InChIKey | WLQLQWXPNOACIL-LBPRGKRZSA-N |
| XLogP | 2.22 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |