C15H16N6O3S — CID 136711710
N,N-dimethyl-N'-[7-(4-methylphenyl)sulfonyl-6-oxo-1H-purin-2-yl]methanimidamide (PubChem CID 136711710) has the molecular formula C15H16N6O3S and a molecular weight of 360.40 g/mol. Its IUPAC name is N,N-dimethyl-N'-[7-(4-methylphenyl)sulfonyl-6-oxo-1H-purin-2-yl]methanimidamide.
| Compound Name | N,N-dimethyl-N'-[7-(4-methylphenyl)sulfonyl-6-oxo-1H-purin-2-yl]methanimidamide |
|---|---|
| PubChem CID | 136711710 |
| Molecular Formula | C15H16N6O3S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N,N-dimethyl-N'-[7-(4-methylphenyl)sulfonyl-6-oxo-1H-purin-2-yl]methanimidamide |
| SMILES | Cc1ccc(S(=O)(=O)n2cnc3nc(/N=C/N(C)C)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C15H16N6O3S/c1-10-4-6-11(7-5-10)25(23,24)21-9-16-13-12(21)14(22)19-15(18-13)17-8-20(2)3/h4-9H,1-3H3,(H,18,19,22)/b17-8+ |
| InChIKey | AOGPMSAIKBSBPX-CAOOACKPSA-N |
| XLogP | 0.89 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|