C11H9FN2O4S — CID 562851
5-fluoro-1-(4-methylphenyl)sulfonylpyrimidine-2,4-dione (PubChem CID 562851) has the molecular formula C11H9FN2O4S and a molecular weight of 284.27 g/mol. Its IUPAC name is 5-fluoro-1-(4-methylphenyl)sulfonylpyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-(4-methylphenyl)sulfonylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 562851 |
| Molecular Formula | C11H9FN2O4S |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 5-fluoro-1-(4-methylphenyl)sulfonylpyrimidine-2,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(F)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C11H9FN2O4S/c1-7-2-4-8(5-3-7)19(17,18)14-6-9(12)10(15)13-11(14)16/h2-6H,1H3,(H,13,15,16) |
| InChIKey | PIZNOQYLTZXNRN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |