C21H26N2O4S — CID 11704090
5-dec-1-ynyl-1-(4-methylphenyl)sulfonylpyrimidine-2,4-dione (PubChem CID 11704090) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is 5-dec-1-ynyl-1-(4-methylphenyl)sulfonylpyrimidine-2,4-dione.
| Compound Name | 5-dec-1-ynyl-1-(4-methylphenyl)sulfonylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11704090 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 5-dec-1-ynyl-1-(4-methylphenyl)sulfonylpyrimidine-2,4-dione |
| SMILES | CCCCCCCCC#Cc1cn(S(=O)(=O)c2ccc(C)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H26N2O4S/c1-3-4-5-6-7-8-9-10-11-18-16-23(21(25)22-20(18)24)28(26,27)19-14-12-17(2)13-15-19/h12-16H,3-9H2,1-2H3,(H,22,24,25) |
| InChIKey | RDINIXPZAGAXDO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|