C14H15FN2O5S — CID 3064714
1-(4-butoxyphenyl)sulfonyl-5-fluoropyrimidine-2,4-dione (PubChem CID 3064714) has the molecular formula C14H15FN2O5S and a molecular weight of 342.35 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)sulfonyl-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-(4-butoxyphenyl)sulfonyl-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3064714 |
| Molecular Formula | C14H15FN2O5S |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-(4-butoxyphenyl)sulfonyl-5-fluoropyrimidine-2,4-dione |
| SMILES | CCCCOc1ccc(S(=O)(=O)n2cc(F)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C14H15FN2O5S/c1-2-3-8-22-10-4-6-11(7-5-10)23(20,21)17-9-12(15)13(18)16-14(17)19/h4-7,9H,2-3,8H2,1H3,(H,16,18,19) |
| InChIKey | QAGFCWPECNQFNN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|