C22H27N3O3S — CID 10161068
1-(4-butoxyphenyl)sulfonyl-4-piperazin-1-ylindole (PubChem CID 10161068) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)sulfonyl-4-piperazin-1-ylindole.
| Compound Name | 1-(4-butoxyphenyl)sulfonyl-4-piperazin-1-ylindole |
|---|---|
| PubChem CID | 10161068 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 1-(4-butoxyphenyl)sulfonyl-4-piperazin-1-ylindole |
| SMILES | CCCCOc1ccc(S(=O)(=O)n2ccc3c(N4CCNCC4)cccc32)cc1 |
| InChI | InChI=1S/C22H27N3O3S/c1-2-3-17-28-18-7-9-19(10-8-18)29(26,27)25-14-11-20-21(5-4-6-22(20)25)24-15-12-23-13-16-24/h4-11,14,23H,2-3,12-13,15-17H2,1H3 |
| InChIKey | WCKBNMZFLVNNEO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|